C20H37ClN2O5S — CID 58932148
(2S)-5-butyl-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]azepane-2-carboxamide (PubChem CID 58932148) has the molecular formula C20H37ClN2O5S and a molecular weight of 453.05 g/mol. Its IUPAC name is (2S)-5-butyl-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]azepane-2-carboxamide.
| Compound Name | (2S)-5-butyl-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]azepane-2-carboxamide |
|---|---|
| PubChem CID | 58932148 |
| Molecular Formula | C20H37ClN2O5S |
| Molecular Weight | 453.05 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (2S)-5-butyl-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]azepane-2-carboxamide |
| SMILES | CCCCC1CCN[C@H](C(=O)N[C@@H]([C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)[C@H](C)Cl)CC1 |
| InChI | InChI=1S/C20H37ClN2O5S/c1-4-5-6-12-7-8-13(22-10-9-12)19(27)23-14(11(2)21)18-16(25)15(24)17(26)20(28-18)29-3/h11-18,20,22,24-26H,4-10H2,1-3H3,(H,23,27)/t11-,12?,13-,14+,15-,16+,17+,18+,20+/m0/s1 |
| InChIKey | OILNKSOGCLVNBR-SBRAHHPMSA-N |
| XLogP | 1.22 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.05 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|