C18H31ClF2N2O5S — CID 58667944
(5R)-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-5-(2,2-difluoroethyl)azepane-2-carboxamide (PubChem CID 58667944) has the molecular formula C18H31ClF2N2O5S and a molecular weight of 460.97 g/mol. Its IUPAC name is (5R)-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-5-(2,2-difluoroethyl)azepane-2-carboxamide.
| Compound Name | (5R)-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-5-(2,2-difluoroethyl)azepane-2-carboxamide |
|---|---|
| PubChem CID | 58667944 |
| Molecular Formula | C18H31ClF2N2O5S |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | (5R)-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-5-(2,2-difluoroethyl)azepane-2-carboxamide |
| SMILES | CSC1OC(C(NC(=O)C2CC[C@@H](CC(F)F)CCN2)C(C)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C18H31ClF2N2O5S/c1-8(19)12(16-14(25)13(24)15(26)18(28-16)29-2)23-17(27)10-4-3-9(5-6-22-10)7-11(20)21/h8-16,18,22,24-26H,3-7H2,1-2H3,(H,23,27)/t8?,9-,10?,12?,13?,14?,15?,16?,18?/m1/s1 |
| InChIKey | NHJAEPFVDSHUGW-MHRWJWFSSA-N |
| XLogP | 0.68 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|