C26H39ClF2N2O5S — CID 142528766
(2S,5S)-N-[(2S)-2-chloro-1-[(2R,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[4-(3,5-difluorophenyl)butyl]azepane-2-carboxamide (PubChem CID 142528766) has the molecular formula C26H39ClF2N2O5S and a molecular weight of 565.12 g/mol. Its IUPAC name is (2S,5S)-N-[(2S)-2-chloro-1-[(2R,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[4-(3,5-difluorophenyl)butyl]azepane-2-carboxamide.
| Compound Name | (2S,5S)-N-[(2S)-2-chloro-1-[(2R,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[4-(3,5-difluorophenyl)butyl]azepane-2-carboxamide |
|---|---|
| PubChem CID | 142528766 |
| Molecular Formula | C26H39ClF2N2O5S |
| Molecular Weight | 565.12 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | (2S,5S)-N-[(2S)-2-chloro-1-[(2R,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[4-(3,5-difluorophenyl)butyl]azepane-2-carboxamide |
| SMILES | CSC1OC(C(NC(=O)[C@@H]2CC[C@H](CCCCc3cc(F)cc(F)c3)CCN2)[C@H](C)Cl)C(O)C(O)[C@H]1O |
| InChI | InChI=1S/C26H39ClF2N2O5S/c1-14(27)20(24-22(33)21(32)23(34)26(36-24)37-2)31-25(35)19-8-7-15(9-10-30-19)5-3-4-6-16-11-17(28)13-18(29)12-16/h11-15,19-24,26,30,32-34H,3-10H2,1-2H3,(H,31,35)/t14-,15-,19-,20?,21?,22?,23+,24?,26?/m0/s1 |
| InChIKey | OZYRIYLCSBUQHT-GAPHKZOUSA-N |
| XLogP | 2.72 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.12 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|