C24H43ClN2O4S — CID 137488281
N-[2-chloro-1-[(3S)-3,5-dihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(3-cyclopentylpropyl)azepane-2-carboxamide (PubChem CID 137488281) has the molecular formula C24H43ClN2O4S and a molecular weight of 491.14 g/mol. Its IUPAC name is N-[2-chloro-1-[(3S)-3,5-dihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(3-cyclopentylpropyl)azepane-2-carboxamide.
| Compound Name | N-[2-chloro-1-[(3S)-3,5-dihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(3-cyclopentylpropyl)azepane-2-carboxamide |
|---|---|
| PubChem CID | 137488281 |
| Molecular Formula | C24H43ClN2O4S |
| Molecular Weight | 491.14 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | N-[2-chloro-1-[(3S)-3,5-dihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(3-cyclopentylpropyl)azepane-2-carboxamide |
| SMILES | CSC1OC(C(NC(=O)C2CCC(CCCC3CCCC3)CCN2)C(C)Cl)[C@@H](O)CC1O |
| InChI | InChI=1S/C24H43ClN2O4S/c1-15(25)21(22-19(28)14-20(29)24(31-22)32-2)27-23(30)18-11-10-17(12-13-26-18)9-5-8-16-6-3-4-7-16/h15-22,24,26,28-29H,3-14H2,1-2H3,(H,27,30)/t15?,17?,18?,19-,20?,21?,22?,24?/m0/s1 |
| InChIKey | KRRVLUIPZRCITQ-JNAUZTFLSA-N |
| XLogP | 3.42 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.14 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|