C22H37ClN2O6S — CID 89279039
[(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S)-5-(cyclopropylmethyl)azepane-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] acetate (PubChem CID 89279039) has the molecular formula C22H37ClN2O6S and a molecular weight of 493.07 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S)-5-(cyclopropylmethyl)azepane-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S)-5-(cyclopropylmethyl)azepane-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 89279039 |
| Molecular Formula | C22H37ClN2O6S |
| Molecular Weight | 493.07 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S)-5-(cyclopropylmethyl)azepane-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] acetate |
| SMILES | CS[C@H]1O[C@H]([C@H](NC(=O)[C@@H]2CCC(CC3CC3)CCN2)[C@H](C)Cl)[C@H](O)[C@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H37ClN2O6S/c1-11(23)16(19-17(27)18(28)20(30-12(2)26)22(31-19)32-3)25-21(29)15-7-6-14(8-9-24-15)10-13-4-5-13/h11,13-20,22,24,27-28H,4-10H2,1-3H3,(H,25,29)/t11-,14?,15-,16+,17+,18-,19+,20+,22+/m0/s1 |
| InChIKey | AMHHHUOGTZRAKW-VVGWCNLISA-N |
| XLogP | 1.40 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.07 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|