C18H31ClN2O5S — CID 58840510
(2S,4R)-N-[(1S,2S)-2-chloro-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(cyclopropylmethyl)pyrrolidine-2-carboxamide (PubChem CID 58840510) has the molecular formula C18H31ClN2O5S and a molecular weight of 422.98 g/mol. Its IUPAC name is (2S,4R)-N-[(1S,2S)-2-chloro-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(cyclopropylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1S,2S)-2-chloro-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(cyclopropylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58840510 |
| Molecular Formula | C18H31ClN2O5S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (2S,4R)-N-[(1S,2S)-2-chloro-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(cyclopropylmethyl)pyrrolidine-2-carboxamide |
| SMILES | CS[C@H]1OC([C@H](NC(=O)[C@@H]2C[C@@H](CC3CC3)CN2)[C@H](C)Cl)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H31ClN2O5S/c1-8(19)12(16-14(23)13(22)15(24)18(26-16)27-2)21-17(25)11-6-10(7-20-11)5-9-3-4-9/h8-16,18,20,22-24H,3-7H2,1-2H3,(H,21,25)/t8-,10+,11-,12+,13-,14+,15+,16?,18+/m0/s1 |
| InChIKey | QDEOIFYJYVIITD-COIRMCEASA-N |
| XLogP | 0.05 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|