C16H29ClN2O5S2 — CID 89365302
(2S,4S)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-ethylsulfanylpyrrolidine-2-carboxamide (PubChem CID 89365302) has the molecular formula C16H29ClN2O5S2 and a molecular weight of 429.00 g/mol. Its IUPAC name is (2S,4S)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-ethylsulfanylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-ethylsulfanylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89365302 |
| Molecular Formula | C16H29ClN2O5S2 |
| Molecular Weight | 429.00 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (2S,4S)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-ethylsulfanylpyrrolidine-2-carboxamide |
| SMILES | CCS[C@@H]1CN[C@H](C(=O)N[C@@H]([C@H]2O[C@H](SC)C(O)[C@@H](O)[C@H]2O)[C@H](C)Cl)C1 |
| InChI | InChI=1S/C16H29ClN2O5S2/c1-4-26-8-5-9(18-6-8)15(23)19-10(7(2)17)14-12(21)11(20)13(22)16(24-14)25-3/h7-14,16,18,20-22H,4-6H2,1-3H3,(H,19,23)/t7-,8-,9-,10+,11-,12+,13?,14+,16+/m0/s1 |
| InChIKey | LOTXOLDKOMAKAY-FQOWZPROSA-N |
| XLogP | -0.25 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.00 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|