C26H38INO8S — CID 160789975
2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(1S,3S)-3-propylcyclopentanecarbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2-iodobenzoate (PubChem CID 160789975) has the molecular formula C26H38INO8S and a molecular weight of 651.56 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(1S,3S)-3-propylcyclopentanecarbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2-iodobenzoate.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(1S,3S)-3-propylcyclopentanecarbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2-iodobenzoate |
|---|---|
| PubChem CID | 160789975 |
| Molecular Formula | C26H38INO8S |
| Molecular Weight | 651.56 g/mol |
| Exact Mass | 651.14 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(1S,3S)-3-propylcyclopentanecarbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2-iodobenzoate |
| SMILES | CCC[C@H]1CC[C@H](C(=O)N[C@@H]([C@H]2O[C@H](SCCOC(=O)c3ccccc3I)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](C)O)C1 |
| InChI | InChI=1S/C26H38INO8S/c1-3-6-15-9-10-16(13-15)24(33)28-19(14(2)29)23-21(31)20(30)22(32)26(36-23)37-12-11-35-25(34)17-7-4-5-8-18(17)27/h4-5,7-8,14-16,19-23,26,29-32H,3,6,9-13H2,1-2H3,(H,28,33)/t14-,15+,16+,19-,20+,21-,22-,23-,26-/m1/s1 |
| InChIKey | IIEQYESKYOXVDH-MLCWCQJGSA-N |
| XLogP | 2.07 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|