C27H42N2O10S — CID 153312671
2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2,5-dihydroxybenzoate (PubChem CID 153312671) has the molecular formula C27H42N2O10S and a molecular weight of 586.70 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2,5-dihydroxybenzoate.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 153312671 |
| Molecular Formula | C27H42N2O10S |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2,5-dihydroxybenzoate |
| SMILES | CCC[C@@H]1C[C@@H](C(=O)N[C@@H]([C@H]2O[C@H](SCCOC(=O)c3cc(O)ccc3O)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](C)OC)N(C)C1 |
| InChI | InChI=1S/C27H42N2O10S/c1-5-6-15-11-18(29(3)13-15)25(35)28-20(14(2)37-4)24-22(33)21(32)23(34)27(39-24)40-10-9-38-26(36)17-12-16(30)7-8-19(17)31/h7-8,12,14-15,18,20-24,27,30-34H,5-6,9-11,13H2,1-4H3,(H,28,35)/t14-,15-,18+,20-,21+,22-,23-,24-,27-/m1/s1 |
| InChIKey | KTBXHZCTXWFDDW-FPZXYBNWSA-N |
| XLogP | 0.44 |
| TPSA | 178.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|