C18H33ClFN2O8PS — CID 69222250
[6-[2-chloro-1-[(4-fluoro-4-propylpiperidine-2-carbonyl)amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate (PubChem CID 69222250) has the molecular formula C18H33ClFN2O8PS and a molecular weight of 522.96 g/mol. Its IUPAC name is [6-[2-chloro-1-[(4-fluoro-4-propylpiperidine-2-carbonyl)amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate.
| Compound Name | [6-[2-chloro-1-[(4-fluoro-4-propylpiperidine-2-carbonyl)amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 69222250 |
| Molecular Formula | C18H33ClFN2O8PS |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | [6-[2-chloro-1-[(4-fluoro-4-propylpiperidine-2-carbonyl)amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate |
| SMILES | CCCC1(F)CCNC(C(=O)NC(C(C)Cl)C2OC(SC)C(OP(=O)(O)O)C(O)C2O)C1 |
| InChI | InChI=1S/C18H33ClFN2O8PS/c1-4-5-18(20)6-7-21-10(8-18)16(25)22-11(9(2)19)14-12(23)13(24)15(17(29-14)32-3)30-31(26,27)28/h9-15,17,21,23-24H,4-8H2,1-3H3,(H,22,25)(H2,26,27,28) |
| InChIKey | PJAIRCFEKPCWHY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|