C25H40ClN2O11PS — CID 73334178
[(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate;2-hydroxybenzoic acid (PubChem CID 73334178) has the molecular formula C25H40ClN2O11PS and a molecular weight of 643.09 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate;2-hydroxybenzoic acid.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate;2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 73334178 |
| Molecular Formula | C25H40ClN2O11PS |
| Molecular Weight | 643.09 g/mol |
| Exact Mass | 642.18 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate;2-hydroxybenzoic acid |
| SMILES | CCC[C@@H]1C[C@@H](C(=O)N[C@@H]([C@H]2O[C@H](SC)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]2O)[C@H](C)Cl)N(C)C1.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C18H34ClN2O8PS.C7H6O3/c1-5-6-10-7-11(21(3)8-10)17(24)20-12(9(2)19)15-13(22)14(23)16(18(28-15)31-4)29-30(25,26)27;8-6-4-2-1-3-5(6)7(9)10/h9-16,18,22-23H,5-8H2,1-4H3,(H,20,24)(H2,25,26,27);1-4,8H,(H,9,10)/t9-,10+,11-,12+,13+,14-,15+,16+,18+;/m0./s1 |
| InChIKey | XDLLXUSFGYRVMV-SHSUDHJHSA-N |
| XLogP | 1.60 |
| TPSA | 206.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.09 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|