C23H41FN2O5S — CID 58840441
(2S)-4-(cyclohexylmethyl)-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide (PubChem CID 58840441) has the molecular formula C23H41FN2O5S and a molecular weight of 476.66 g/mol. Its IUPAC name is (2S)-4-(cyclohexylmethyl)-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide.
| Compound Name | (2S)-4-(cyclohexylmethyl)-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 58840441 |
| Molecular Formula | C23H41FN2O5S |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | (2S)-4-(cyclohexylmethyl)-4-fluoro-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
| SMILES | CS[C@H]1O[C@H]([C@H](NC(=O)[C@@H]2CC(F)(CC3CCCCC3)CCN2)C(C)C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H41FN2O5S/c1-13(2)16(20-18(28)17(27)19(29)22(31-20)32-3)26-21(30)15-12-23(24,9-10-25-15)11-14-7-5-4-6-8-14/h13-20,22,25,27-29H,4-12H2,1-3H3,(H,26,30)/t15-,16+,17-,18+,19+,20+,22+,23?/m0/s1 |
| InChIKey | ULCLTOOZLVZBRY-IWSQPNRRSA-N |
| XLogP | 1.73 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |