C19H34N2O5S — CID 11315627
3-(2-cyclopropylethyl)-N-[2-methyl-1-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]azetidine-2-carboxamide (PubChem CID 11315627) has the molecular formula C19H34N2O5S and a molecular weight of 402.56 g/mol. Its IUPAC name is 3-(2-cyclopropylethyl)-N-[2-methyl-1-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]azetidine-2-carboxamide.
| Compound Name | 3-(2-cyclopropylethyl)-N-[2-methyl-1-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]azetidine-2-carboxamide |
|---|---|
| PubChem CID | 11315627 |
| Molecular Formula | C19H34N2O5S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 3-(2-cyclopropylethyl)-N-[2-methyl-1-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]azetidine-2-carboxamide |
| SMILES | CS[C@@H]1O[C@@H](C(NC(=O)C2NCC2CCC2CC2)C(C)C)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H34N2O5S/c1-9(2)12(17-15(23)14(22)16(24)19(26-17)27-3)21-18(25)13-11(8-20-13)7-6-10-4-5-10/h9-17,19-20,22-24H,4-8H2,1-3H3,(H,21,25)/t11?,12?,13?,14-,15+,16+,17+,19+/m1/s1 |
| InChIKey | HBPIZKFMGNYIGI-KEIIULJUSA-N |
| XLogP | 0.08 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |