C19H36N2O5S — CID 11269708
N-[2-methyl-1-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-3-pentylazetidine-2-carboxamide (PubChem CID 11269708) has the molecular formula C19H36N2O5S and a molecular weight of 404.57 g/mol. Its IUPAC name is N-[2-methyl-1-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-3-pentylazetidine-2-carboxamide.
| Compound Name | N-[2-methyl-1-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-3-pentylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 11269708 |
| Molecular Formula | C19H36N2O5S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N-[2-methyl-1-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-3-pentylazetidine-2-carboxamide |
| SMILES | CCCCCC1CNC1C(=O)NC(C(C)C)[C@@H]1O[C@@H](SC)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H36N2O5S/c1-5-6-7-8-11-9-20-13(11)18(25)21-12(10(2)3)17-15(23)14(22)16(24)19(26-17)27-4/h10-17,19-20,22-24H,5-9H2,1-4H3,(H,21,25)/t11?,12?,13?,14-,15+,16+,17+,19+/m1/s1 |
| InChIKey | IYVKECZBVGCDJK-KEIIULJUSA-N |
| XLogP | 0.47 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|