C22H39N3O5S — CID 89279045
(2S,4R)-1-(cyanomethyl)-N-[(1R)-2-methyl-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-pentylpyrrolidine-2-carboxamide (PubChem CID 89279045) has the molecular formula C22H39N3O5S and a molecular weight of 457.64 g/mol. Its IUPAC name is (2S,4R)-1-(cyanomethyl)-N-[(1R)-2-methyl-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-pentylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-(cyanomethyl)-N-[(1R)-2-methyl-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-pentylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89279045 |
| Molecular Formula | C22H39N3O5S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (2S,4R)-1-(cyanomethyl)-N-[(1R)-2-methyl-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-pentylpyrrolidine-2-carboxamide |
| SMILES | CCCCC[C@@H]1C[C@@H](C(=O)N[C@H](C(C)C)C2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)N(CC#N)C1 |
| InChI | InChI=1S/C22H39N3O5S/c1-5-6-7-8-14-11-15(25(12-14)10-9-23)21(29)24-16(13(2)3)20-18(27)17(26)19(28)22(30-20)31-4/h13-20,22,26-28H,5-8,10-12H2,1-4H3,(H,24,29)/t14-,15+,16-,17+,18-,19-,20?,22-/m1/s1 |
| InChIKey | HARUDSUZZMKALL-GDVMXCMRSA-N |
| XLogP | 1.09 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|