C18H35Cl2N2O6S- — CID 53313151
(2S,4R)-N-[2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide;chloride;hydrate (PubChem CID 53313151) has the molecular formula C18H35Cl2N2O6S- and a molecular weight of 478.46 g/mol. Its IUPAC name is (2S,4R)-N-[2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide;chloride;hydrate.
| Compound Name | (2S,4R)-N-[2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide;chloride;hydrate |
|---|---|
| PubChem CID | 53313151 |
| Molecular Formula | C18H35Cl2N2O6S- |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (2S,4R)-N-[2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide;chloride;hydrate |
| SMILES | CCC[C@@H]1C[C@@H](C(=O)NC(C(C)Cl)C2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)N(C)C1.O.[Cl-] |
| InChI | InChI=1S/C18H33ClN2O5S.ClH.H2O/c1-5-6-10-7-11(21(3)8-10)17(25)20-12(9(2)19)16-14(23)13(22)15(24)18(26-16)27-4;;/h9-16,18,22-24H,5-8H2,1-4H3,(H,20,25);1H;1H2/p-1/t9?,10-,11+,12?,13+,14-,15-,16?,18-;;/m1../s1 |
| InChIKey | KWMXKEGEOADCEQ-WXNMBWLVSA-M |
| XLogP | -3.43 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|