C17H31ClN2O5S — CID 163053731
(2S,4R)-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-ethyl-1-methylpyrrolidine-2-carboxamide (PubChem CID 163053731) has the molecular formula C17H31ClN2O5S and a molecular weight of 410.96 g/mol. Its IUPAC name is (2S,4R)-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-ethyl-1-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-ethyl-1-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163053731 |
| Molecular Formula | C17H31ClN2O5S |
| Molecular Weight | 410.96 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (2S,4R)-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-ethyl-1-methylpyrrolidine-2-carboxamide |
| SMILES | CC[C@@H]1C[C@@H](C(=O)NC(C(C)Cl)C2OC(SC)C(O)C(O)C2O)N(C)C1 |
| InChI | InChI=1S/C17H31ClN2O5S/c1-5-9-6-10(20(3)7-9)16(24)19-11(8(2)18)15-13(22)12(21)14(23)17(25-15)26-4/h8-15,17,21-23H,5-7H2,1-4H3,(H,19,24)/t8?,9-,10+,11?,12?,13?,14?,15?,17?/m1/s1 |
| InChIKey | UHQYIIRIOVIPLI-VCRJVWJBSA-N |
| XLogP | -0.00 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.96 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|