C18H34ClN2O8PS — CID 51064166
[(2S,3S,4R,5S,6S)-6-[(1R)-2-chloro-1-[[(2R,4S)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate (PubChem CID 51064166) has the molecular formula C18H34ClN2O8PS and a molecular weight of 504.97 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-6-[(1R)-2-chloro-1-[[(2R,4S)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate.
| Compound Name | [(2S,3S,4R,5S,6S)-6-[(1R)-2-chloro-1-[[(2R,4S)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 51064166 |
| Molecular Formula | C18H34ClN2O8PS |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-6-[(1R)-2-chloro-1-[[(2R,4S)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]-4,5-dihydroxy-2-methylsulfanyloxan-3-yl] dihydrogen phosphate |
| SMILES | CCC[C@H]1C[C@H](C(=O)N[C@@H](C(C)Cl)[C@@H]2O[C@@H](SC)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H]2O)N(C)C1 |
| InChI | InChI=1S/C18H34ClN2O8PS/c1-5-6-10-7-11(21(3)8-10)17(24)20-12(9(2)19)15-13(22)14(23)16(18(28-15)31-4)29-30(25,26)27/h9-16,18,22-23H,5-8H2,1-4H3,(H,20,24)(H2,25,26,27)/t9?,10-,11+,12-,13-,14+,15-,16-,18-/m0/s1 |
| InChIKey | UFUVLHLTWXBHGZ-GHGYQPCPSA-N |
| XLogP | 0.51 |
| TPSA | 148.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|