C24H44FNO2 — CID 168971412
2-ethylbutyl 6-butyl-2-tert-butyl-6-fluoro-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-3-carboxylate (PubChem CID 168971412) has the molecular formula C24H44FNO2 and a molecular weight of 397.62 g/mol. Its IUPAC name is 2-ethylbutyl 6-butyl-2-tert-butyl-6-fluoro-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-3-carboxylate.
| Compound Name | 2-ethylbutyl 6-butyl-2-tert-butyl-6-fluoro-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 168971412 |
| Molecular Formula | C24H44FNO2 |
| Molecular Weight | 397.62 g/mol |
| Exact Mass | 397.34 |
| IUPAC Name | 2-ethylbutyl 6-butyl-2-tert-butyl-6-fluoro-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-3-carboxylate |
| SMILES | CCCCC1(F)CCC2CN(C(C)(C)C)C(C(=O)OCC(CC)CC)CC2C1 |
| InChI | InChI=1S/C24H44FNO2/c1-7-10-12-24(25)13-11-19-16-26(23(4,5)6)21(14-20(19)15-24)22(27)28-17-18(8-2)9-3/h18-21H,7-17H2,1-6H3 |
| InChIKey | LGKDENINZLYLRP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |