C27H45N5O6 — CID 168971654
2-O-tert-butyl 3-O-(2-ethylbutyl) (3S,4aR,6R,8aR)-6-[2-[2-(acetyloxymethyl)tetrazol-5-yl]ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 168971654) has the molecular formula C27H45N5O6 and a molecular weight of 535.69 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-(2-ethylbutyl) (3S,4aR,6R,8aR)-6-[2-[2-(acetyloxymethyl)tetrazol-5-yl]ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-(2-ethylbutyl) (3S,4aR,6R,8aR)-6-[2-[2-(acetyloxymethyl)tetrazol-5-yl]ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168971654 |
| Molecular Formula | C27H45N5O6 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.34 |
| IUPAC Name | 2-O-tert-butyl 3-O-(2-ethylbutyl) (3S,4aR,6R,8aR)-6-[2-[2-(acetyloxymethyl)tetrazol-5-yl]ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | CCC(CC)COC(=O)[C@@H]1C[C@H]2C[C@@H](CCc3nnn(COC(C)=O)n3)CC[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H45N5O6/c1-7-19(8-2)16-36-25(34)23-14-22-13-20(10-12-24-28-30-32(29-24)17-37-18(3)33)9-11-21(22)15-31(23)26(35)38-27(4,5)6/h19-23H,7-17H2,1-6H3/t20-,21+,22-,23+/m1/s1 |
| InChIKey | YFGDVTIMVDBDMW-ACESQOTJSA-N |
| XLogP | 4.15 |
| TPSA | 125.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|