C24H39N5O4 — CID 162432824
2-O-tert-butyl 3-O-(2-ethylbutyl) (3S,4aR,6E,8aR)-6-[2-(2H-tetrazol-5-yl)ethylidene]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate (PubChem CID 162432824) has the molecular formula C24H39N5O4 and a molecular weight of 461.61 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-(2-ethylbutyl) (3S,4aR,6E,8aR)-6-[2-(2H-tetrazol-5-yl)ethylidene]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-(2-ethylbutyl) (3S,4aR,6E,8aR)-6-[2-(2H-tetrazol-5-yl)ethylidene]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 162432824 |
| Molecular Formula | C24H39N5O4 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 2-O-tert-butyl 3-O-(2-ethylbutyl) (3S,4aR,6E,8aR)-6-[2-(2H-tetrazol-5-yl)ethylidene]-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate |
| SMILES | CCC(CC)COC(=O)[C@@H]1C[C@H]2C/C(=C/Cc3nn[nH]n3)CC[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H39N5O4/c1-6-16(7-2)15-32-22(30)20-13-19-12-17(9-11-21-25-27-28-26-21)8-10-18(19)14-29(20)23(31)33-24(3,4)5/h9,16,18-20H,6-8,10-15H2,1-5H3,(H,25,26,27,28)/b17-9+/t18-,19+,20-/m0/s1 |
| InChIKey | AAWLZHXHHKZRFL-PCQQMKMSSA-N |
| XLogP | 4.07 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|