C33H56O6 — CID 59030152
2-ethylhexyl 4,7-dibutyl-4,7-diethyl-1,10-dioxo-2,9-dioxadispiro[4.0.46.45]tetradecane-12-carboxylate (PubChem CID 59030152) has the molecular formula C33H56O6 and a molecular weight of 548.81 g/mol. Its IUPAC name is 2-ethylhexyl 4,7-dibutyl-4,7-diethyl-1,10-dioxo-2,9-dioxadispiro[4.0.46.45]tetradecane-12-carboxylate.
| Compound Name | 2-ethylhexyl 4,7-dibutyl-4,7-diethyl-1,10-dioxo-2,9-dioxadispiro[4.0.46.45]tetradecane-12-carboxylate |
|---|---|
| PubChem CID | 59030152 |
| Molecular Formula | C33H56O6 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.41 |
| IUPAC Name | 2-ethylhexyl 4,7-dibutyl-4,7-diethyl-1,10-dioxo-2,9-dioxadispiro[4.0.46.45]tetradecane-12-carboxylate |
| SMILES | CCCCC(CC)COC(=O)C1CCC2(C(=O)OCC2(CC)CCCC)C2(C1)C(=O)OCC2(CC)CCCC |
| InChI | InChI=1S/C33H56O6/c1-7-13-16-25(10-4)22-37-27(34)26-17-20-32(28(35)38-23-30(32,11-5)18-14-8-2)33(21-26)29(36)39-24-31(33,12-6)19-15-9-3/h25-26H,7-24H2,1-6H3 |
| InChIKey | MSKMZOWPJQJVAB-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|