C23H38O6 — CID 174499423
4-O-(2-ethylhexyl) 1-O-(2-methylpropyl) 1-prop-2-enoyloxycyclohexane-1,4-dicarboxylate (PubChem CID 174499423) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is 4-O-(2-ethylhexyl) 1-O-(2-methylpropyl) 1-prop-2-enoyloxycyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-(2-ethylhexyl) 1-O-(2-methylpropyl) 1-prop-2-enoyloxycyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 174499423 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 4-O-(2-ethylhexyl) 1-O-(2-methylpropyl) 1-prop-2-enoyloxycyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OC1(C(=O)OCC(C)C)CCC(C(=O)OCC(CC)CCCC)CC1 |
| InChI | InChI=1S/C23H38O6/c1-6-9-10-18(7-2)16-27-21(25)19-11-13-23(14-12-19,29-20(24)8-3)22(26)28-15-17(4)5/h8,17-19H,3,6-7,9-16H2,1-2,4-5H3 |
| InChIKey | DKMHYFPUIDTTEC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|