C29H50O6 — CID 174499308
3-O-decyl 1-O-(6-methylheptyl) 1-prop-2-enoyloxycyclohexane-1,3-dicarboxylate (PubChem CID 174499308) has the molecular formula C29H50O6 and a molecular weight of 494.71 g/mol. Its IUPAC name is 3-O-decyl 1-O-(6-methylheptyl) 1-prop-2-enoyloxycyclohexane-1,3-dicarboxylate.
| Compound Name | 3-O-decyl 1-O-(6-methylheptyl) 1-prop-2-enoyloxycyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 174499308 |
| Molecular Formula | C29H50O6 |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | 3-O-decyl 1-O-(6-methylheptyl) 1-prop-2-enoyloxycyclohexane-1,3-dicarboxylate |
| SMILES | C=CC(=O)OC1(C(=O)OCCCCCC(C)C)CCCC(C(=O)OCCCCCCCCCC)C1 |
| InChI | InChI=1S/C29H50O6/c1-5-7-8-9-10-11-12-15-21-33-27(31)25-19-17-20-29(23-25,35-26(30)6-2)28(32)34-22-16-13-14-18-24(3)4/h6,24-25H,2,5,7-23H2,1,3-4H3 |
| InChIKey | WMEUAZHAWWTPFY-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|