C28H48O6 — CID 174499543
1-O-heptyl 3-O-(2-propylheptyl) 1-prop-2-enoyloxycyclohexane-1,3-dicarboxylate (PubChem CID 174499543) has the molecular formula C28H48O6 and a molecular weight of 480.69 g/mol. Its IUPAC name is 1-O-heptyl 3-O-(2-propylheptyl) 1-prop-2-enoyloxycyclohexane-1,3-dicarboxylate.
| Compound Name | 1-O-heptyl 3-O-(2-propylheptyl) 1-prop-2-enoyloxycyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 174499543 |
| Molecular Formula | C28H48O6 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | 1-O-heptyl 3-O-(2-propylheptyl) 1-prop-2-enoyloxycyclohexane-1,3-dicarboxylate |
| SMILES | C=CC(=O)OC1(C(=O)OCCCCCCC)CCCC(C(=O)OCC(CCC)CCCCC)C1 |
| InChI | InChI=1S/C28H48O6/c1-5-9-11-12-14-20-32-27(31)28(34-25(29)8-4)19-15-18-24(21-28)26(30)33-22-23(16-7-3)17-13-10-6-2/h8,23-24H,4-7,9-22H2,1-3H3 |
| InChIKey | HOUCPPJUYARHPX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|