C29H54O4 — CID 66984372
3-O-(9-methyldecyl) 1-O-(2-propylheptyl) cyclohexane-1,3-dicarboxylate (PubChem CID 66984372) has the molecular formula C29H54O4 and a molecular weight of 466.75 g/mol. Its IUPAC name is 3-O-(9-methyldecyl) 1-O-(2-propylheptyl) cyclohexane-1,3-dicarboxylate.
| Compound Name | 3-O-(9-methyldecyl) 1-O-(2-propylheptyl) cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 66984372 |
| Molecular Formula | C29H54O4 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.40 |
| IUPAC Name | 3-O-(9-methyldecyl) 1-O-(2-propylheptyl) cyclohexane-1,3-dicarboxylate |
| SMILES | CCCCCC(CCC)COC(=O)C1CCCC(C(=O)OCCCCCCCCC(C)C)C1 |
| InChI | InChI=1S/C29H54O4/c1-5-7-12-18-25(16-6-2)23-33-29(31)27-20-15-19-26(22-27)28(30)32-21-14-11-9-8-10-13-17-24(3)4/h24-27H,5-23H2,1-4H3 |
| InChIKey | ODNRKPKEGCGFTQ-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|