C23H42O4 — CID 66983673
1-O-pentyl 2-O-(2-propylheptyl) cyclohexane-1,2-dicarboxylate (PubChem CID 66983673) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is 1-O-pentyl 2-O-(2-propylheptyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-pentyl 2-O-(2-propylheptyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66983673 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | 1-O-pentyl 2-O-(2-propylheptyl) cyclohexane-1,2-dicarboxylate |
| SMILES | CCCCCOC(=O)C1CCCCC1C(=O)OCC(CCC)CCCCC |
| InChI | InChI=1S/C23H42O4/c1-4-7-9-14-19(13-6-3)18-27-23(25)21-16-11-10-15-20(21)22(24)26-17-12-8-5-2/h19-21H,4-18H2,1-3H3 |
| InChIKey | KZRQQPXNFKRWOK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|