C20H36O5 — CID 66984031
2-[2-(2-propylheptoxy)ethoxycarbonyl]cyclohexane-1-carboxylic acid (PubChem CID 66984031) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is 2-[2-(2-propylheptoxy)ethoxycarbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[2-(2-propylheptoxy)ethoxycarbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 66984031 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 2-[2-(2-propylheptoxy)ethoxycarbonyl]cyclohexane-1-carboxylic acid |
| SMILES | CCCCCC(CCC)COCCOC(=O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C20H36O5/c1-3-5-6-10-16(9-4-2)15-24-13-14-25-20(23)18-12-8-7-11-17(18)19(21)22/h16-18H,3-15H2,1-2H3,(H,21,22) |
| InChIKey | NRDYTJAKXNVRHV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|