C21H38O4 — CID 141262883
2-(2-methyl-4-propylnonan-2-yl)oxycarbonylcyclohexane-1-carboxylic acid (PubChem CID 141262883) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is 2-(2-methyl-4-propylnonan-2-yl)oxycarbonylcyclohexane-1-carboxylic acid.
| Compound Name | 2-(2-methyl-4-propylnonan-2-yl)oxycarbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 141262883 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 2-(2-methyl-4-propylnonan-2-yl)oxycarbonylcyclohexane-1-carboxylic acid |
| SMILES | CCCCCC(CCC)CC(C)(C)OC(=O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C21H38O4/c1-5-7-8-12-16(11-6-2)15-21(3,4)25-20(24)18-14-10-9-13-17(18)19(22)23/h16-18H,5-15H2,1-4H3,(H,22,23) |
| InChIKey | FGTQMSOPMXKOPG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|