C19H34O4 — CID 66983795
3-O-methyl 1-O-(2-propylheptyl) cyclohexane-1,3-dicarboxylate (PubChem CID 66983795) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is 3-O-methyl 1-O-(2-propylheptyl) cyclohexane-1,3-dicarboxylate.
| Compound Name | 3-O-methyl 1-O-(2-propylheptyl) cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 66983795 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 3-O-methyl 1-O-(2-propylheptyl) cyclohexane-1,3-dicarboxylate |
| SMILES | CCCCCC(CCC)COC(=O)C1CCCC(C(=O)OC)C1 |
| InChI | InChI=1S/C19H34O4/c1-4-6-7-10-15(9-5-2)14-23-19(21)17-12-8-11-16(13-17)18(20)22-3/h15-17H,4-14H2,1-3H3 |
| InChIKey | FGFJPVYHCRXSCX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|