C32H58O6 — CID 174160323
tris(2-ethylhexyl) cyclopentane-1,2,4-tricarboxylate (PubChem CID 174160323) has the molecular formula C32H58O6 and a molecular weight of 538.81 g/mol. Its IUPAC name is tris(2-ethylhexyl) cyclopentane-1,2,4-tricarboxylate.
| Compound Name | tris(2-ethylhexyl) cyclopentane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 174160323 |
| Molecular Formula | C32H58O6 |
| Molecular Weight | 538.81 g/mol |
| Exact Mass | 538.42 |
| IUPAC Name | tris(2-ethylhexyl) cyclopentane-1,2,4-tricarboxylate |
| SMILES | CCCCC(CC)COC(=O)C1CC(C(=O)OCC(CC)CCCC)C(C(=O)OCC(CC)CCCC)C1 |
| InChI | InChI=1S/C32H58O6/c1-7-13-16-24(10-4)21-36-30(33)27-19-28(31(34)37-22-25(11-5)17-14-8-2)29(20-27)32(35)38-23-26(12-6)18-15-9-3/h24-29H,7-23H2,1-6H3 |
| InChIKey | HJRADMCCBMDJDR-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.81 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|