C24H46O4 — CID 138600539
2-ethylhexyl 4-[(R)-2-ethylhexoxy(hydroxy)methyl]cyclohexane-1-carboxylate (PubChem CID 138600539) has the molecular formula C24H46O4 and a molecular weight of 398.63 g/mol. Its IUPAC name is 2-ethylhexyl 4-[(R)-2-ethylhexoxy(hydroxy)methyl]cyclohexane-1-carboxylate.
| Compound Name | 2-ethylhexyl 4-[(R)-2-ethylhexoxy(hydroxy)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 138600539 |
| Molecular Formula | C24H46O4 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | 2-ethylhexyl 4-[(R)-2-ethylhexoxy(hydroxy)methyl]cyclohexane-1-carboxylate |
| SMILES | CCCCC(CC)COC(=O)C1CCC([C@H](O)OCC(CC)CCCC)CC1 |
| InChI | InChI=1S/C24H46O4/c1-5-9-11-19(7-3)17-27-23(25)21-13-15-22(16-14-21)24(26)28-18-20(8-4)12-10-6-2/h19-23,25H,5-18H2,1-4H3/t19?,20?,21?,22?,23-/m1/s1 |
| InChIKey | UVDPEMLZDGUIET-PMNLSXDQSA-N |
| XLogP | 6.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|