About 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate
2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate (PubChem CID 155455206) has the molecular formula C22H42O5
and a molecular weight of 386.57 g/mol. Its IUPAC name is 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate |
| PubChem CID | 155455206 |
| Molecular Formula | C22H42O5 |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate |
| SMILES | CCCCOCCOC(O)C1CCCC(C(=O)OCC(CC)CCCC)C1 |
| InChI | InChI=1S/C22H42O5/c1-4-7-10-18(6-3)17-27-22(24)20-12-9-11-19(16-20)21(23)26-15-14-25-13-8-5-2/h18-21,23H,4-17H2,1-3H3 |
| InChIKey | FYXKGIRBKMPUCO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate?
The IUPAC name of 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate (CID 155455206) is 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate.
What is the SMILES notation for 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate?
The canonical SMILES for 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate is CCCCOCCOC(O)C1CCCC(C(=O)OCC(CC)CCCC)C1.
What is the InChIKey of 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate?
The InChIKey is FYXKGIRBKMPUCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O5/c1-4-7-10-18(6-3)17-27-22(24)20-12-9-11-19(16-20)21(23)26-15-14-25-13-8-5-2/h18-21,23H,4-17H2,1-3H3.
What are the key properties of 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate?
2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate has a molecular weight of 386.57 g/mol, XLogP of 4.70, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 3-[2-butoxyethoxy(hydroxy)methyl]cyclohexane-1-carboxylate is sourced from PubChem (CID 155455206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).