C22H40O5 — CID 155455065
1-O-(2-butoxyethyl) 4-O-(2-ethylhexyl) cyclohexane-1,4-dicarboxylate (PubChem CID 155455065) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is 1-O-(2-butoxyethyl) 4-O-(2-ethylhexyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-(2-butoxyethyl) 4-O-(2-ethylhexyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 155455065 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 1-O-(2-butoxyethyl) 4-O-(2-ethylhexyl) cyclohexane-1,4-dicarboxylate |
| SMILES | CCCCOCCOC(=O)C1CCC(C(=O)OCC(CC)CCCC)CC1 |
| InChI | InChI=1S/C22H40O5/c1-4-7-9-18(6-3)17-27-22(24)20-12-10-19(11-13-20)21(23)26-16-15-25-14-8-5-2/h18-20H,4-17H2,1-3H3 |
| InChIKey | GMMPWBYQNYTKAJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|