C18H35FN4O2 — CID 162432832
2-methylpropyl (6R)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoroazecane-2-carboxylate (PubChem CID 162432832) has the molecular formula C18H35FN4O2 and a molecular weight of 358.50 g/mol. Its IUPAC name is 2-methylpropyl (6R)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoroazecane-2-carboxylate.
| Compound Name | 2-methylpropyl (6R)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoroazecane-2-carboxylate |
|---|---|
| PubChem CID | 162432832 |
| Molecular Formula | C18H35FN4O2 |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 2-methylpropyl (6R)-6-[(3Z)-3-amino-3-(methylhydrazinylidene)propyl]-6-fluoroazecane-2-carboxylate |
| SMILES | CN/N=C(\N)CC[C@@]1(F)CCCCNC(C(=O)OCC(C)C)CCC1 |
| InChI | InChI=1S/C18H35FN4O2/c1-14(2)13-25-17(24)15-7-6-10-18(19,9-4-5-12-22-15)11-8-16(20)23-21-3/h14-15,21-22H,4-13H2,1-3H3,(H2,20,23)/t15?,18-/m1/s1 |
| InChIKey | FJTGNVHXPLSIPC-KPMSDPLLSA-N |
| XLogP | 2.48 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|