About pentan-2-yl azepane-2-carboxylate
pentan-2-yl azepane-2-carboxylate (PubChem CID 102982576) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is pentan-2-yl azepane-2-carboxylate.
Molecular Properties
| Compound Name | pentan-2-yl azepane-2-carboxylate |
| PubChem CID | 102982576 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | pentan-2-yl azepane-2-carboxylate |
| SMILES | CCCC(C)OC(=O)C1CCCCCN1 |
| InChI | InChI=1S/C12H23NO2/c1-3-7-10(2)15-12(14)11-8-5-4-6-9-13-11/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | GGWMDTGDDWVSAH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pentan-2-yl azepane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl azepane-2-carboxylate?
The IUPAC name of pentan-2-yl azepane-2-carboxylate (CID 102982576) is pentan-2-yl azepane-2-carboxylate.
What is the SMILES notation for pentan-2-yl azepane-2-carboxylate?
The canonical SMILES for pentan-2-yl azepane-2-carboxylate is CCCC(C)OC(=O)C1CCCCCN1.
What is the InChIKey of pentan-2-yl azepane-2-carboxylate?
The InChIKey is GGWMDTGDDWVSAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-3-7-10(2)15-12(14)11-8-5-4-6-9-13-11/h10-11,13H,3-9H2,1-2H3.
What are the key properties of pentan-2-yl azepane-2-carboxylate?
pentan-2-yl azepane-2-carboxylate has a molecular weight of 213.32 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl azepane-2-carboxylate is sourced from PubChem (CID 102982576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).