About pentan-2-yl piperidine-2-carboxylate
pentan-2-yl piperidine-2-carboxylate (PubChem CID 102982469) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is pentan-2-yl piperidine-2-carboxylate.
Molecular Properties
| Compound Name | pentan-2-yl piperidine-2-carboxylate |
| PubChem CID | 102982469 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | pentan-2-yl piperidine-2-carboxylate |
| SMILES | CCCC(C)OC(=O)C1CCCCN1 |
| InChI | InChI=1S/C11H21NO2/c1-3-6-9(2)14-11(13)10-7-4-5-8-12-10/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | FPEMZSQENISUJK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pentan-2-yl piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl piperidine-2-carboxylate?
The IUPAC name of pentan-2-yl piperidine-2-carboxylate (CID 102982469) is pentan-2-yl piperidine-2-carboxylate.
What is the SMILES notation for pentan-2-yl piperidine-2-carboxylate?
The canonical SMILES for pentan-2-yl piperidine-2-carboxylate is CCCC(C)OC(=O)C1CCCCN1.
What is the InChIKey of pentan-2-yl piperidine-2-carboxylate?
The InChIKey is FPEMZSQENISUJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-3-6-9(2)14-11(13)10-7-4-5-8-12-10/h9-10,12H,3-8H2,1-2H3.
What are the key properties of pentan-2-yl piperidine-2-carboxylate?
pentan-2-yl piperidine-2-carboxylate has a molecular weight of 199.29 g/mol, XLogP of 1.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl piperidine-2-carboxylate is sourced from PubChem (CID 102982469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).