About chloromethane;(2R)-pyrrolidine-2-carboxamide
chloromethane;(2R)-pyrrolidine-2-carboxamide (PubChem CID 143336240) has the molecular formula C6H13ClN2O
and a molecular weight of 164.64 g/mol. Its IUPAC name is chloromethane;(2R)-pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | chloromethane;(2R)-pyrrolidine-2-carboxamide |
| PubChem CID | 143336240 |
| Molecular Formula | C6H13ClN2O |
| Molecular Weight | 164.64 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | chloromethane;(2R)-pyrrolidine-2-carboxamide |
| SMILES | CCl.NC(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C5H10N2O.CH3Cl/c6-5(8)4-2-1-3-7-4;1-2/h4,7H,1-3H2,(H2,6,8);1H3/t4-;/m1./s1 |
| InChIKey | VUBLLZHWCUQDDS-PGMHMLKASA-N |
| XLogP | 0.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.64 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;(2R)-pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;(2R)-pyrrolidine-2-carboxamide?
The IUPAC name of chloromethane;(2R)-pyrrolidine-2-carboxamide (CID 143336240) is chloromethane;(2R)-pyrrolidine-2-carboxamide.
What is the SMILES notation for chloromethane;(2R)-pyrrolidine-2-carboxamide?
The canonical SMILES for chloromethane;(2R)-pyrrolidine-2-carboxamide is CCl.NC(=O)[C@H]1CCCN1.
What is the InChIKey of chloromethane;(2R)-pyrrolidine-2-carboxamide?
The InChIKey is VUBLLZHWCUQDDS-PGMHMLKASA-N. The full InChI is InChI=1S/C5H10N2O.CH3Cl/c6-5(8)4-2-1-3-7-4;1-2/h4,7H,1-3H2,(H2,6,8);1H3/t4-;/m1./s1.
What are the key properties of chloromethane;(2R)-pyrrolidine-2-carboxamide?
chloromethane;(2R)-pyrrolidine-2-carboxamide has a molecular weight of 164.64 g/mol, XLogP of 0.08, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;(2R)-pyrrolidine-2-carboxamide is sourced from PubChem (CID 143336240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).