About ethane;2-methylpentane;pyrrolidine-2-carboxamide
ethane;2-methylpentane;pyrrolidine-2-carboxamide (PubChem CID 177141949) has the molecular formula C13H30N2O
and a molecular weight of 230.40 g/mol. Its IUPAC name is ethane;2-methylpentane;pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | ethane;2-methylpentane;pyrrolidine-2-carboxamide |
| PubChem CID | 177141949 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | ethane;2-methylpentane;pyrrolidine-2-carboxamide |
| SMILES | CC.CCCC(C)C.NC(=O)C1CCCN1 |
| InChI | InChI=1S/C6H14.C5H10N2O.C2H6/c1-4-5-6(2)3;6-5(8)4-2-1-3-7-4;1-2/h6H,4-5H2,1-3H3;4,7H,1-3H2,(H2,6,8);1-2H3 |
| InChIKey | BHNISVUNTAPLNL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methylpentane;pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpentane;pyrrolidine-2-carboxamide?
The IUPAC name of ethane;2-methylpentane;pyrrolidine-2-carboxamide (CID 177141949) is ethane;2-methylpentane;pyrrolidine-2-carboxamide.
What is the SMILES notation for ethane;2-methylpentane;pyrrolidine-2-carboxamide?
The canonical SMILES for ethane;2-methylpentane;pyrrolidine-2-carboxamide is CC.CCCC(C)C.NC(=O)C1CCCN1.
What is the InChIKey of ethane;2-methylpentane;pyrrolidine-2-carboxamide?
The InChIKey is BHNISVUNTAPLNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C5H10N2O.C2H6/c1-4-5-6(2)3;6-5(8)4-2-1-3-7-4;1-2/h6H,4-5H2,1-3H3;4,7H,1-3H2,(H2,6,8);1-2H3.
What are the key properties of ethane;2-methylpentane;pyrrolidine-2-carboxamide?
ethane;2-methylpentane;pyrrolidine-2-carboxamide has a molecular weight of 230.40 g/mol, XLogP of 2.69, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpentane;pyrrolidine-2-carboxamide is sourced from PubChem (CID 177141949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).