C13H20N2O4S — CID 172751245
4-methylbenzenesulfonic acid;(3R)-piperidine-3-carboxamide (PubChem CID 172751245) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;(3R)-piperidine-3-carboxamide.
| Compound Name | 4-methylbenzenesulfonic acid;(3R)-piperidine-3-carboxamide |
|---|---|
| PubChem CID | 172751245 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-methylbenzenesulfonic acid;(3R)-piperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC(=O)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C7H8O3S.C6H12N2O/c1-6-2-4-7(5-3-6)11(8,9)10;7-6(9)5-2-1-3-8-4-5/h2-5H,1H3,(H,8,9,10);5,8H,1-4H2,(H2,7,9)/t;5-/m.1/s1 |
| InChIKey | KKCJTBNXRRYLKU-QDXATWJZSA-N |
| XLogP | 0.71 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|