C8H16N2O — CID 11469201
(3S)-N,N-dimethylpiperidine-3-carboxamide (PubChem CID 11469201) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (3S)-N,N-dimethylpiperidine-3-carboxamide.
| Compound Name | (3S)-N,N-dimethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 11469201 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (3S)-N,N-dimethylpiperidine-3-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CCCNC1 |
| InChI | InChI=1S/C8H16N2O/c1-10(2)8(11)7-4-3-5-9-6-7/h7,9H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | KLSDFCJMDZZDKK-ZETCQYMHSA-N |
| XLogP | 0.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |