C8H17CsN2O — CID 177005866
cesium;carbanide;N,N-dimethylpyrrolidine-3-carboxamide (PubChem CID 177005866) has the molecular formula C8H17CsN2O and a molecular weight of 290.14 g/mol. Its IUPAC name is cesium;carbanide;N,N-dimethylpyrrolidine-3-carboxamide.
| Compound Name | cesium;carbanide;N,N-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 177005866 |
| Molecular Formula | C8H17CsN2O |
| Molecular Weight | 290.14 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | cesium;carbanide;N,N-dimethylpyrrolidine-3-carboxamide |
| SMILES | CN(C)C(=O)C1CCNC1.[CH3-].[Cs+] |
| InChI | InChI=1S/C7H14N2O.CH3.Cs/c1-9(2)7(10)6-3-4-8-5-6;;/h6,8H,3-5H2,1-2H3;1H3;/q;-1;+1 |
| InChIKey | PFXCSEWJVQDDPF-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.14 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|