C18H30 — CID 143467578
(3E)-2-methylhexa-1,3-diene;[(3Z)-penta-1,3-dien-2-yl]cyclohexane (PubChem CID 143467578) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is (3E)-2-methylhexa-1,3-diene;[(3Z)-penta-1,3-dien-2-yl]cyclohexane.
| Compound Name | (3E)-2-methylhexa-1,3-diene;[(3Z)-penta-1,3-dien-2-yl]cyclohexane |
|---|---|
| PubChem CID | 143467578 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | (3E)-2-methylhexa-1,3-diene;[(3Z)-penta-1,3-dien-2-yl]cyclohexane |
| SMILES | C=C(/C=C\C)C1CCCCC1.C=C(C)/C=C/CC |
| InChI | InChI=1S/C11H18.C7H12/c1-3-7-10(2)11-8-5-4-6-9-11;1-4-5-6-7(2)3/h3,7,11H,2,4-6,8-9H2,1H3;5-6H,2,4H2,1,3H3/b7-3-;6-5+ |
| InChIKey | BBKSDIIYNAWAQW-GNJCOXQTSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|