C11H18O — CID 101161499
cis-(1R,2S)-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol (PubChem CID 101161499) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 101161499 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | cis-(1R,2S)-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexan-1-ol |
| SMILES | C=C(C)/C=C/[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C11H18O/c1-9(2)7-8-10-5-3-4-6-11(10)12/h7-8,10-12H,1,3-6H2,2H3/b8-7+/t10-,11+/m0/s1 |
| InChIKey | IKRCLFLRRRJRMJ-IAYMVZNDSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|