C11H18O — CID 11971200
2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol (PubChem CID 11971200) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol.
| Compound Name | 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol |
|---|---|
| PubChem CID | 11971200 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol |
| SMILES | CC(C)C1=CC=C(CCO)CC1 |
| InChI | InChI=1S/C11H18O/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3,5,9,12H,4,6-8H2,1-2H3 |
| InChIKey | OFRCGWBLTNNKGZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |