About 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol
2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol (PubChem CID 11971200) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol |
| PubChem CID | 11971200 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol |
| SMILES | CC(C)C1=CC=C(CCO)CC1 |
| InChI | InChI=1S/C11H18O/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3,5,9,12H,4,6-8H2,1-2H3 |
| InChIKey | OFRCGWBLTNNKGZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol?
The IUPAC name of 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol (CID 11971200) is 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol.
What is the SMILES notation for 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol?
The canonical SMILES for 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol is CC(C)C1=CC=C(CCO)CC1.
What is the InChIKey of 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol?
The InChIKey is OFRCGWBLTNNKGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3,5,9,12H,4,6-8H2,1-2H3.
What are the key properties of 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol?
2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol has a molecular weight of 166.26 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)ethanol is sourced from PubChem (CID 11971200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).