C18H29NO — CID 155030355
[(2Z,4Z)-6-methyl-1-nitrosohepta-2,4,6-trien-3-yl]cyclodecane (PubChem CID 155030355) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is [(2Z,4Z)-6-methyl-1-nitrosohepta-2,4,6-trien-3-yl]cyclodecane.
| Compound Name | [(2Z,4Z)-6-methyl-1-nitrosohepta-2,4,6-trien-3-yl]cyclodecane |
|---|---|
| PubChem CID | 155030355 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | [(2Z,4Z)-6-methyl-1-nitrosohepta-2,4,6-trien-3-yl]cyclodecane |
| SMILES | C=C(C)/C=C\C(=C/CN=O)C1CCCCCCCCC1 |
| InChI | InChI=1S/C18H29NO/c1-16(2)12-13-18(14-15-19-20)17-10-8-6-4-3-5-7-9-11-17/h12-14,17H,1,3-11,15H2,2H3/b13-12-,18-14+ |
| InChIKey | HLXLUZBXPBTRDP-BFJFDWDHSA-N |
| XLogP | 5.95 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|