About 2-cyclohexylpent-2-enoic acid
2-cyclohexylpent-2-enoic acid (PubChem CID 67108594) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-cyclohexylpent-2-enoic acid.
Molecular Properties
| Compound Name | 2-cyclohexylpent-2-enoic acid |
| PubChem CID | 67108594 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-cyclohexylpent-2-enoic acid |
| SMILES | CCC=C(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C11H18O2/c1-2-6-10(11(12)13)9-7-4-3-5-8-9/h6,9H,2-5,7-8H2,1H3,(H,12,13) |
| InChIKey | ICDSRGCPMBVUFX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylpent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylpent-2-enoic acid?
The IUPAC name of 2-cyclohexylpent-2-enoic acid (CID 67108594) is 2-cyclohexylpent-2-enoic acid.
What is the SMILES notation for 2-cyclohexylpent-2-enoic acid?
The canonical SMILES for 2-cyclohexylpent-2-enoic acid is CCC=C(C(=O)O)C1CCCCC1.
What is the InChIKey of 2-cyclohexylpent-2-enoic acid?
The InChIKey is ICDSRGCPMBVUFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-2-6-10(11(12)13)9-7-4-3-5-8-9/h6,9H,2-5,7-8H2,1H3,(H,12,13).
What are the key properties of 2-cyclohexylpent-2-enoic acid?
2-cyclohexylpent-2-enoic acid has a molecular weight of 182.26 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylpent-2-enoic acid is sourced from PubChem (CID 67108594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).