About cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid
cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid (PubChem CID 67426263) has the molecular formula C13H20O7
and a molecular weight of 288.30 g/mol. Its IUPAC name is cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid.
Molecular Properties
| Compound Name | cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid |
| PubChem CID | 67426263 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid |
| SMILES | CC/C=C(\O)C(=O)O.O=C(O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C8H12O4.C5H8O3/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-2-3-4(6)5(7)8/h5-6H,1-4H2,(H,9,10)(H,11,12);3,6H,2H2,1H3,(H,7,8)/b;4-3- |
| InChIKey | BIWCTVYJTOGJCJ-QGAMPUOQSA-N |
| XLogP | 1.88 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid?
The IUPAC name of cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid (CID 67426263) is cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid.
What is the SMILES notation for cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid?
The canonical SMILES for cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid is CC/C=C(\O)C(=O)O.O=C(O)C1CCCCC1C(=O)O.
What is the InChIKey of cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid?
The InChIKey is BIWCTVYJTOGJCJ-QGAMPUOQSA-N. The full InChI is InChI=1S/C8H12O4.C5H8O3/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-2-3-4(6)5(7)8/h5-6H,1-4H2,(H,9,10)(H,11,12);3,6H,2H2,1H3,(H,7,8)/b;4-3-.
What are the key properties of cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid?
cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid has a molecular weight of 288.30 g/mol, XLogP of 1.88, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,2-dicarboxylic acid;(Z)-2-hydroxypent-2-enoic acid is sourced from PubChem (CID 67426263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).