About cyclopentanecarboxylic acid;propanal
cyclopentanecarboxylic acid;propanal (PubChem CID 91501922) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is cyclopentanecarboxylic acid;propanal.
Molecular Properties
| Compound Name | cyclopentanecarboxylic acid;propanal |
| PubChem CID | 91501922 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | cyclopentanecarboxylic acid;propanal |
| SMILES | CCC=O.O=C(O)C1CCCC1 |
| InChI | InChI=1S/C6H10O2.C3H6O/c7-6(8)5-3-1-2-4-5;1-2-3-4/h5H,1-4H2,(H,7,8);3H,2H2,1H3 |
| InChIKey | JLBGSDNUGBQNEM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cyclopentanecarboxylic acid;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanecarboxylic acid;propanal?
The IUPAC name of cyclopentanecarboxylic acid;propanal (CID 91501922) is cyclopentanecarboxylic acid;propanal.
What is the SMILES notation for cyclopentanecarboxylic acid;propanal?
The canonical SMILES for cyclopentanecarboxylic acid;propanal is CCC=O.O=C(O)C1CCCC1.
What is the InChIKey of cyclopentanecarboxylic acid;propanal?
The InChIKey is JLBGSDNUGBQNEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C3H6O/c7-6(8)5-3-1-2-4-5;1-2-3-4/h5H,1-4H2,(H,7,8);3H,2H2,1H3.
What are the key properties of cyclopentanecarboxylic acid;propanal?
cyclopentanecarboxylic acid;propanal has a molecular weight of 172.22 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanecarboxylic acid;propanal is sourced from PubChem (CID 91501922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).