About cyclohexanecarboxylic acid;N-ethylethanamine
cyclohexanecarboxylic acid;N-ethylethanamine (PubChem CID 175970280) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is cyclohexanecarboxylic acid;N-ethylethanamine.
Molecular Properties
| Compound Name | cyclohexanecarboxylic acid;N-ethylethanamine |
| PubChem CID | 175970280 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | cyclohexanecarboxylic acid;N-ethylethanamine |
| SMILES | CCNCC.O=C(O)C1CCCCC1 |
| InChI | InChI=1S/C7H12O2.C4H11N/c8-7(9)6-4-2-1-3-5-6;1-3-5-4-2/h6H,1-5H2,(H,8,9);5H,3-4H2,1-2H3 |
| InChIKey | BDHPRYDOISUSEX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexanecarboxylic acid;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanecarboxylic acid;N-ethylethanamine?
The IUPAC name of cyclohexanecarboxylic acid;N-ethylethanamine (CID 175970280) is cyclohexanecarboxylic acid;N-ethylethanamine.
What is the SMILES notation for cyclohexanecarboxylic acid;N-ethylethanamine?
The canonical SMILES for cyclohexanecarboxylic acid;N-ethylethanamine is CCNCC.O=C(O)C1CCCCC1.
What is the InChIKey of cyclohexanecarboxylic acid;N-ethylethanamine?
The InChIKey is BDHPRYDOISUSEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C4H11N/c8-7(9)6-4-2-1-3-5-6;1-3-5-4-2/h6H,1-5H2,(H,8,9);5H,3-4H2,1-2H3.
What are the key properties of cyclohexanecarboxylic acid;N-ethylethanamine?
cyclohexanecarboxylic acid;N-ethylethanamine has a molecular weight of 201.31 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanecarboxylic acid;N-ethylethanamine is sourced from PubChem (CID 175970280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).